C37H35Cl2N3O5S — CID 59293949
ethyl (Z)-4-[[5-(4-chlorophenyl)-2-[(E)-N-(4-chlorophenyl)sulfonyl-C-(2,4,6-trimethylphenyl)carbonimidoyl]-4-phenyl-3H-pyrazol-4-yl]oxy]but-2-enoate (PubChem CID 59293949) has the molecular formula C37H35Cl2N3O5S and a molecular weight of 704.68 g/mol. Its IUPAC name is ethyl (Z)-4-[[5-(4-chlorophenyl)-2-[(E)-N-(4-chlorophenyl)sulfonyl-C-(2,4,6-trimethylphenyl)carbonimidoyl]-4-phenyl-3H-pyrazol-4-yl]oxy]but-2-enoate.
| Compound Name | ethyl (Z)-4-[[5-(4-chlorophenyl)-2-[(E)-N-(4-chlorophenyl)sulfonyl-C-(2,4,6-trimethylphenyl)carbonimidoyl]-4-phenyl-3H-pyrazol-4-yl]oxy]but-2-enoate |
|---|---|
| PubChem CID | 59293949 |
| Molecular Formula | C37H35Cl2N3O5S |
| Molecular Weight | 704.68 g/mol |
| Exact Mass | 703.17 |
| IUPAC Name | ethyl (Z)-4-[[5-(4-chlorophenyl)-2-[(E)-N-(4-chlorophenyl)sulfonyl-C-(2,4,6-trimethylphenyl)carbonimidoyl]-4-phenyl-3H-pyrazol-4-yl]oxy]but-2-enoate |
| SMILES | CCOC(=O)/C=C\COC1(c2ccccc2)CN(/C(=N/S(=O)(=O)c2ccc(Cl)cc2)c2c(C)cc(C)cc2C)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H35Cl2N3O5S/c1-5-46-33(43)12-9-21-47-37(29-10-7-6-8-11-29)24-42(40-35(37)28-13-15-30(38)16-14-28)36(34-26(3)22-25(2)23-27(34)4)41-48(44,45)32-19-17-31(39)18-20-32/h6-20,22-23H,5,21,24H2,1-4H3/b12-9-,41-36+ |
| InChIKey | HFHWISRLRPWUST-QDOODJDHSA-N |
| XLogP | 7.81 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|