About 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial
3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial (PubChem CID 59294735) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial.
Molecular Properties
| Compound Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial |
| PubChem CID | 59294735 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial |
| SMILES | CC(C)=CCC/C(C)=C/CCC(CC=O)CCC=O |
| InChI | InChI=1S/C17H28O2/c1-15(2)7-4-8-16(3)9-5-10-17(12-14-19)11-6-13-18/h7,9,13-14,17H,4-6,8,10-12H2,1-3H3/b16-9+ |
| InChIKey | GXUXVLNCPUIABT-CXUHLZMHSA-N |
| XLogP | 4.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial?
The IUPAC name of 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial (CID 59294735) is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial.
What is the SMILES notation for 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial?
The canonical SMILES for 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial is CC(C)=CCC/C(C)=C/CCC(CC=O)CCC=O.
What is the InChIKey of 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial?
The InChIKey is GXUXVLNCPUIABT-CXUHLZMHSA-N. The full InChI is InChI=1S/C17H28O2/c1-15(2)7-4-8-16(3)9-5-10-17(12-14-19)11-6-13-18/h7,9,13-14,17H,4-6,8,10-12H2,1-3H3/b16-9+.
What are the key properties of 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial?
3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial has a molecular weight of 264.41 g/mol, XLogP of 4.64, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-4,8-dimethylnona-3,7-dienyl]hexanedial is sourced from PubChem (CID 59294735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).