C18H20ClF3N4O4S2 — CID 59295425
2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(trifluoromethylsulfonyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59295425) has the molecular formula C18H20ClF3N4O4S2 and a molecular weight of 512.96 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(trifluoromethylsulfonyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(trifluoromethylsulfonyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59295425 |
| Molecular Formula | C18H20ClF3N4O4S2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(trifluoromethylsulfonyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | Cc1nc(C2CCN(S(=O)(=O)C(F)(F)F)CC2)sc1COc1ccc(/C(N)=N/O)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClF3N4O4S2/c1-10-15(9-30-12-2-3-13(14(19)8-12)16(23)25-27)31-17(24-10)11-4-6-26(7-5-11)32(28,29)18(20,21)22/h2-3,8,11,27H,4-7,9H2,1H3,(H2,23,25) |
| InChIKey | OOFHVSVJZQZGJU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|