C19H22ClF3N4O2S — CID 59295431
2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide (PubChem CID 59295431) has the molecular formula C19H22ClF3N4O2S and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59295431 |
| Molecular Formula | C19H22ClF3N4O2S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-[[4-methyl-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1,3-thiazol-5-yl]methoxy]benzenecarboximidamide |
| SMILES | Cc1nc(C2CCN(CC(F)(F)F)CC2)sc1COc1ccc(/C(N)=N/O)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClF3N4O2S/c1-11-16(9-29-13-2-3-14(15(20)8-13)17(24)26-28)30-18(25-11)12-4-6-27(7-5-12)10-19(21,22)23/h2-3,8,12,28H,4-7,9-10H2,1H3,(H2,24,26) |
| InChIKey | LBDLAUGHINUHFR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|