C22H21F3N2O3S — CID 59295526
ethyl 4-(3-phenylmethoxypropyl)-2-[6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-5-carboxylate (PubChem CID 59295526) has the molecular formula C22H21F3N2O3S and a molecular weight of 450.48 g/mol. Its IUPAC name is ethyl 4-(3-phenylmethoxypropyl)-2-[6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-(3-phenylmethoxypropyl)-2-[6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59295526 |
| Molecular Formula | C22H21F3N2O3S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 4-(3-phenylmethoxypropyl)-2-[6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(C(F)(F)F)nc2)nc1CCCOCc1ccccc1 |
| InChI | InChI=1S/C22H21F3N2O3S/c1-2-30-21(28)19-17(9-6-12-29-14-15-7-4-3-5-8-15)27-20(31-19)16-10-11-18(26-13-16)22(23,24)25/h3-5,7-8,10-11,13H,2,6,9,12,14H2,1H3 |
| InChIKey | BSIJAAHYPPRWKE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|