C24H25N — CID 59295530
4-tert-butyl-6-phenyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene (PubChem CID 59295530) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-tert-butyl-6-phenyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene.
| Compound Name | 4-tert-butyl-6-phenyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
|---|---|
| PubChem CID | 59295530 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 4-tert-butyl-6-phenyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C24H25N/c1-24(2,3)22-16-21(18-10-5-4-6-11-18)20-15-9-13-17-12-7-8-14-19(17)23(20)25-22/h4-8,10-12,14,16H,9,13,15H2,1-3H3 |
| InChIKey | VCWZLONCUVMTNY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |