C16H24N2O2 — CID 59295549
5,5-dimethylspiro[1,3-dioxane-2,7'-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridine]-3'-amine (PubChem CID 59295549) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5,5-dimethylspiro[1,3-dioxane-2,7'-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridine]-3'-amine.
| Compound Name | 5,5-dimethylspiro[1,3-dioxane-2,7'-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridine]-3'-amine |
|---|---|
| PubChem CID | 59295549 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 5,5-dimethylspiro[1,3-dioxane-2,7'-6,8,9,10-tetrahydro-5H-cycloocta[b]pyridine]-3'-amine |
| SMILES | CC1(C)COC2(CCCc3ncc(N)cc3CC2)OC1 |
| InChI | InChI=1S/C16H24N2O2/c1-15(2)10-19-16(20-11-15)6-3-4-14-12(5-7-16)8-13(17)9-18-14/h8-9H,3-7,10-11,17H2,1-2H3 |
| InChIKey | GCYVVMKWQZNRLL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |