C30H40FN9O2Si — CID 59295805
10-[2-[4-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 59295805) has the molecular formula C30H40FN9O2Si and a molecular weight of 605.80 g/mol. Its IUPAC name is 10-[2-[4-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[2-[4-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 59295805 |
| Molecular Formula | C30H40FN9O2Si |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 10-[2-[4-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorophenyl]piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(F)c(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c1 |
| InChI | InChI=1S/C30H40FN9O2Si/c1-20(42-43(5,6)30(2,3)4)21-9-10-23(31)24(18-21)38-14-11-37(12-15-38)13-16-39-27-22(19-33-39)28-34-26(25-8-7-17-41-25)36-40(28)29(32)35-27/h7-10,17-20H,11-16H2,1-6H3,(H2,32,35)/t20-/m0/s1 |
| InChIKey | ZUIOGASILASJHM-FQEVSTJZSA-N |
| XLogP | 5.36 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|