About phenyliminomethanethiol;yttrium
phenyliminomethanethiol;yttrium (PubChem CID 59296211) has the molecular formula C7H5NSY-2
and a molecular weight of 224.10 g/mol. Its IUPAC name is phenyliminomethanethiol;yttrium.
Molecular Properties
| Compound Name | phenyliminomethanethiol;yttrium |
| PubChem CID | 59296211 |
| Molecular Formula | C7H5NSY-2 |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.92 |
| IUPAC Name | phenyliminomethanethiol;yttrium |
| SMILES | S/[C-]=N/c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C7H5NS.Y/c9-6-8-7-4-2-1-3-5-7;/h1-4H,(H,8,9);/q-2; |
| InChIKey | JCFKLYLTCUHECH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenyliminomethanethiol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyliminomethanethiol;yttrium?
The IUPAC name of phenyliminomethanethiol;yttrium (CID 59296211) is phenyliminomethanethiol;yttrium.
What is the SMILES notation for phenyliminomethanethiol;yttrium?
The canonical SMILES for phenyliminomethanethiol;yttrium is S/[C-]=N/c1[c-]cccc1.[Y].
What is the InChIKey of phenyliminomethanethiol;yttrium?
The InChIKey is JCFKLYLTCUHECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.Y/c9-6-8-7-4-2-1-3-5-7;/h1-4H,(H,8,9);/q-2;.
What are the key properties of phenyliminomethanethiol;yttrium?
phenyliminomethanethiol;yttrium has a molecular weight of 224.10 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyliminomethanethiol;yttrium is sourced from PubChem (CID 59296211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).