C29H56N2O4 — CID 59296357
3-[8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctyl]-1-methylimidazolidine-2,4-dione (PubChem CID 59296357) has the molecular formula C29H56N2O4 and a molecular weight of 496.78 g/mol. Its IUPAC name is 3-[8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59296357 |
| Molecular Formula | C29H56N2O4 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.42 |
| IUPAC Name | 3-[8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CCC(CC)(CCCCO)CCCCOCCCCC(CC)(CC)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C29H56N2O4/c1-6-28(7-2,17-10-13-22-32)18-11-14-23-35-24-15-12-19-29(8-3,9-4)20-16-21-31-26(33)25-30(5)27(31)34/h32H,6-25H2,1-5H3 |
| InChIKey | NPYSUVFQGORYIW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|