C38H40N2S4 — CID 59297174
5-(3-hexyl-5-phenylthiophen-2-yl)-2-[5-(3-hexyl-5-phenylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole (PubChem CID 59297174) has the molecular formula C38H40N2S4 and a molecular weight of 653.02 g/mol. Its IUPAC name is 5-(3-hexyl-5-phenylthiophen-2-yl)-2-[5-(3-hexyl-5-phenylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole.
| Compound Name | 5-(3-hexyl-5-phenylthiophen-2-yl)-2-[5-(3-hexyl-5-phenylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 59297174 |
| Molecular Formula | C38H40N2S4 |
| Molecular Weight | 653.02 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 5-(3-hexyl-5-phenylthiophen-2-yl)-2-[5-(3-hexyl-5-phenylthiophen-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
| SMILES | CCCCCCc1cc(-c2ccccc2)sc1-c1cnc(-c2ncc(-c3sc(-c4ccccc4)cc3CCCCCC)s2)s1 |
| InChI | InChI=1S/C38H40N2S4/c1-3-5-7-11-21-29-23-31(27-17-13-9-14-18-27)41-35(29)33-25-39-37(43-33)38-40-26-34(44-38)36-30(22-12-8-6-4-2)24-32(42-36)28-19-15-10-16-20-28/h9-10,13-20,23-26H,3-8,11-12,21-22H2,1-2H3 |
| InChIKey | SZCFQIKCBAOXCP-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.02 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|