C13H20F5NO — CID 59297284
N-butyl-2-methylidene-N-(3,3,4,4,4-pentafluorobutyl)butanamide (PubChem CID 59297284) has the molecular formula C13H20F5NO and a molecular weight of 301.30 g/mol. Its IUPAC name is N-butyl-2-methylidene-N-(3,3,4,4,4-pentafluorobutyl)butanamide.
| Compound Name | N-butyl-2-methylidene-N-(3,3,4,4,4-pentafluorobutyl)butanamide |
|---|---|
| PubChem CID | 59297284 |
| Molecular Formula | C13H20F5NO |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-butyl-2-methylidene-N-(3,3,4,4,4-pentafluorobutyl)butanamide |
| SMILES | C=C(CC)C(=O)N(CCCC)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H20F5NO/c1-4-6-8-19(11(20)10(3)5-2)9-7-12(14,15)13(16,17)18/h3-9H2,1-2H3 |
| InChIKey | HSNQJZINYCZHRS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|