C23H22F13N2+ — CID 59297338
4-(4-pyridin-4-ylhexan-2-yl)-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyridin-1-ium (PubChem CID 59297338) has the molecular formula C23H22F13N2+ and a molecular weight of 573.42 g/mol. Its IUPAC name is 4-(4-pyridin-4-ylhexan-2-yl)-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyridin-1-ium.
| Compound Name | 4-(4-pyridin-4-ylhexan-2-yl)-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyridin-1-ium |
|---|---|
| PubChem CID | 59297338 |
| Molecular Formula | C23H22F13N2+ |
| Molecular Weight | 573.42 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 4-(4-pyridin-4-ylhexan-2-yl)-1-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)pyridin-1-ium |
| SMILES | CCC(CC(C)c1cc[n+](CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccncc1 |
| InChI | InChI=1S/C23H22F13N2/c1-3-15(17-4-8-37-9-5-17)12-14(2)16-6-10-38(11-7-16)13-18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h4-11,14-15H,3,12-13H2,1-2H3/q+1 |
| InChIKey | RMLPBJLGUSCUMB-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.42 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|