About CID 59297491
CID 59297491 (PubChem CID 59297491) has the molecular formula C9H17BO
and a molecular weight of 152.05 g/mol.
Molecular Properties
| Compound Name | CID 59297491 |
| PubChem CID | 59297491 |
| Molecular Formula | C9H17BO |
| Molecular Weight | 152.05 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](C)C(CC)(CC)O1 |
| InChI | InChI=1S/C9H17BO/c1-4-9(5-2)7(3)6-8(10)11-9/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | PHSXKCUHAARQRU-HTQZYQBOSA-N |
| XLogP | 2.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.05 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59297491 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59297491?
The IUPAC name of CID 59297491 (CID 59297491) is not available.
What is the SMILES notation for CID 59297491?
The canonical SMILES for CID 59297491 is [B][C@H]1C[C@@H](C)C(CC)(CC)O1.
What is the InChIKey of CID 59297491?
The InChIKey is PHSXKCUHAARQRU-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H17BO/c1-4-9(5-2)7(3)6-8(10)11-9/h7-8H,4-6H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of CID 59297491?
CID 59297491 has a molecular weight of 152.05 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59297491 is sourced from PubChem (CID 59297491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).