About ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate
ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate (PubChem CID 59298517) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate |
| PubChem CID | 59298517 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cnccc2c(=O)o1 |
| InChI | InChI=1S/C10H8N2O4/c1-2-15-10(14)8-12-7-5-11-4-3-6(7)9(13)16-8/h3-5H,2H2,1H3 |
| InChIKey | AKPLZDRUMYYGMH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate?
The IUPAC name of ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate (CID 59298517) is ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate.
What is the SMILES notation for ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate?
The canonical SMILES for ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate is CCOC(=O)c1nc2cnccc2c(=O)o1.
What is the InChIKey of ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate?
The InChIKey is AKPLZDRUMYYGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c1-2-15-10(14)8-12-7-5-11-4-3-6(7)9(13)16-8/h3-5H,2H2,1H3.
What are the key properties of ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate?
ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate has a molecular weight of 220.18 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxopyrido[3,4-d][1,3]oxazine-2-carboxylate is sourced from PubChem (CID 59298517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).