About 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium
2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium (PubChem CID 59298955) has the molecular formula C9H10N3Y-
and a molecular weight of 249.11 g/mol. Its IUPAC name is 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium.
Molecular Properties
| Compound Name | 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium |
| PubChem CID | 59298955 |
| Molecular Formula | C9H10N3Y- |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium |
| SMILES | [CH2-]c1nc(CC)nn2cccc12.[Y] |
| InChI | InChI=1S/C9H10N3.Y/c1-3-9-10-7(2)8-5-4-6-12(8)11-9;/h4-6H,2-3H2,1H3;/q-1; |
| InChIKey | MTHOBCJRSUFXTQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium?
The IUPAC name of 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium (CID 59298955) is 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium.
What is the SMILES notation for 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium?
The canonical SMILES for 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium is [CH2-]c1nc(CC)nn2cccc12.[Y].
What is the InChIKey of 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium?
The InChIKey is MTHOBCJRSUFXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N3.Y/c1-3-9-10-7(2)8-5-4-6-12(8)11-9;/h4-6H,2-3H2,1H3;/q-1;.
What are the key properties of 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium?
2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium has a molecular weight of 249.11 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methanidylpyrrolo[2,1-f][1,2,4]triazine;yttrium is sourced from PubChem (CID 59298955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).