About 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one
3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 59299433) has the molecular formula C15H15Cl2NO3
and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 59299433 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCC(Cc1ccc(Cl)cc1Cl)C(=O)N1CCOC1=O |
| InChI | InChI=1S/C15H15Cl2NO3/c1-2-3-11(14(19)18-6-7-21-15(18)20)8-10-4-5-12(16)9-13(10)17/h2,4-5,9,11H,1,3,6-8H2 |
| InChIKey | BUNLFQYURQMGIJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (CID 59299433) is 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one is C=CCC(Cc1ccc(Cl)cc1Cl)C(=O)N1CCOC1=O.
What is the InChIKey of 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is BUNLFQYURQMGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2NO3/c1-2-3-11(14(19)18-6-7-21-15(18)20)8-10-4-5-12(16)9-13(10)17/h2,4-5,9,11H,1,3,6-8H2.
What are the key properties of 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one?
3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 328.20 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2,4-dichlorophenyl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 59299433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).