C17H23NO — CID 59300063
(4Z)-4-butylidene-5,6,7,8-tetramethyl-1,2-dihydroisoquinolin-3-one (PubChem CID 59300063) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (4Z)-4-butylidene-5,6,7,8-tetramethyl-1,2-dihydroisoquinolin-3-one.
| Compound Name | (4Z)-4-butylidene-5,6,7,8-tetramethyl-1,2-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 59300063 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (4Z)-4-butylidene-5,6,7,8-tetramethyl-1,2-dihydroisoquinolin-3-one |
| SMILES | CCC/C=C1\C(=O)NCc2c(C)c(C)c(C)c(C)c21 |
| InChI | InChI=1S/C17H23NO/c1-6-7-8-14-16-13(5)11(3)10(2)12(4)15(16)9-18-17(14)19/h8H,6-7,9H2,1-5H3,(H,18,19)/b14-8- |
| InChIKey | PPGQHCJSEXAHKZ-ZSOIEALJSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|