2,6-dimethoxypyridin-3-amine

C7H10N2O2 — CID 593005

IUPAC2,6-dimethoxypyridin-3-amine
SMILESCOc1ccc(N)c(OC)n1
InChIInChI=1S/C7H10N2O2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,8H2,1-2H3
InChIKeyPTBHRJOTANEONS-UHFFFAOYSA-N
MW154.17 g/mol
LogP0.68
Rot. Bonds2

About 2,6-dimethoxypyridin-3-amine

2,6-dimethoxypyridin-3-amine (PubChem CID 593005) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2,6-dimethoxypyridin-3-amine.

Molecular Properties

Compound Name2,6-dimethoxypyridin-3-amine
PubChem CID593005
Molecular FormulaC7H10N2O2
Molecular Weight154.17 g/mol
Exact Mass154.07
IUPAC Name2,6-dimethoxypyridin-3-amine
SMILESCOc1ccc(N)c(OC)n1
InChIInChI=1S/C7H10N2O2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,8H2,1-2H3
InChIKeyPTBHRJOTANEONS-UHFFFAOYSA-N
XLogP0.68
TPSA57.37 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.17
LogP ≤ 50.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,6-dimethoxypyridin-3-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 81121
CID 81121
CID 2737488
CID 2737488
CID 3017019
CID 3017019
CID 80378
CID 80378
CID 3023919
CID 3023919
CID 20205558
CID 20205558
CID 16791595
CID 16791595
CID 10148998
CID 10148998
CID 21923991
CID 21923991
CID 20786149
CID 20786149
CID 21871817
CID 21871817
CID 3050757
CID 3050757

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethoxypyridin-3-amine?
The IUPAC name of 2,6-dimethoxypyridin-3-amine (CID 593005) is 2,6-dimethoxypyridin-3-amine.
What is the SMILES notation for 2,6-dimethoxypyridin-3-amine?
The canonical SMILES for 2,6-dimethoxypyridin-3-amine is COc1ccc(N)c(OC)n1.
What is the InChIKey of 2,6-dimethoxypyridin-3-amine?
The InChIKey is PTBHRJOTANEONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-10-6-4-3-5(8)7(9-6)11-2/h3-4H,8H2,1-2H3.
What are the key properties of 2,6-dimethoxypyridin-3-amine?
2,6-dimethoxypyridin-3-amine has a molecular weight of 154.17 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxypyridin-3-amine is sourced from PubChem (CID 593005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).