C20H23Cl2N3O3 — CID 59300519
ethyl 2-[(1S)-5-[3-[(2,5-dichloropyrimidin-4-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 59300519) has the molecular formula C20H23Cl2N3O3 and a molecular weight of 424.33 g/mol. Its IUPAC name is ethyl 2-[(1S)-5-[3-[(2,5-dichloropyrimidin-4-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate.
| Compound Name | ethyl 2-[(1S)-5-[3-[(2,5-dichloropyrimidin-4-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 59300519 |
| Molecular Formula | C20H23Cl2N3O3 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | ethyl 2-[(1S)-5-[3-[(2,5-dichloropyrimidin-4-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCc2cc(OCCCNc3nc(Cl)ncc3Cl)ccc21 |
| InChI | InChI=1S/C20H23Cl2N3O3/c1-2-27-18(26)11-14-5-4-13-10-15(6-7-16(13)14)28-9-3-8-23-19-17(21)12-24-20(22)25-19/h6-7,10,12,14H,2-5,8-9,11H2,1H3,(H,23,24,25)/t14-/m0/s1 |
| InChIKey | OXGLVQRCFHYADC-AWEZNQCLSA-N |
| XLogP | 4.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|