C14H18N2O2 — CID 59300643
methyl 8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4-carboxylate (PubChem CID 59300643) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4-carboxylate.
| Compound Name | methyl 8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4-carboxylate |
|---|---|
| PubChem CID | 59300643 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | methyl 8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4-carboxylate |
| SMILES | COC(=O)c1cnc2c(n1)C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-13(2)8-5-6-14(13,3)11-10(8)16-9(7-15-11)12(17)18-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | WJVWIAFJRBLHKZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |