C23H27N5O3 — CID 59300737
pyridin-2-ylmethyl N-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)carbamate (PubChem CID 59300737) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is pyridin-2-ylmethyl N-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)carbamate.
| Compound Name | pyridin-2-ylmethyl N-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)carbamate |
|---|---|
| PubChem CID | 59300737 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | pyridin-2-ylmethyl N-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)carbamate |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cc3[nH]c(NC(=O)OCc4ccccn4)nc3cc21 |
| InChI | InChI=1S/C23H27N5O3/c1-4-5-8-11-28-19-13-18-17(12-16(19)23(2,3)20(28)29)25-21(26-18)27-22(30)31-14-15-9-6-7-10-24-15/h6-7,9-10,12-13H,4-5,8,11,14H2,1-3H3,(H2,25,26,27,30) |
| InChIKey | VJHXSJWIWYFZFN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|