About 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one
5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one (PubChem CID 59300741) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one.
Molecular Properties
| Compound Name | 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one |
| PubChem CID | 59300741 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one |
| SMILES | CC(C)(C)C#CCN1C(=O)C(C)(C)c2cc(N)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H21N3O3/c1-16(2,3)7-6-8-19-13-10-14(20(22)23)12(18)9-11(13)17(4,5)15(19)21/h9-10H,8,18H2,1-5H3 |
| InChIKey | CBMYUOWGZKGZLJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one?
The IUPAC name of 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one (CID 59300741) is 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one.
What is the SMILES notation for 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one?
The canonical SMILES for 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one is CC(C)(C)C#CCN1C(=O)C(C)(C)c2cc(N)c([N+](=O)[O-])cc21.
What is the InChIKey of 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one?
The InChIKey is CBMYUOWGZKGZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-16(2,3)7-6-8-19-13-10-14(20(22)23)12(18)9-11(13)17(4,5)15(19)21/h9-10H,8,18H2,1-5H3.
What are the key properties of 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one?
5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one has a molecular weight of 315.37 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(4,4-dimethylpent-2-ynyl)-3,3-dimethyl-6-nitroindol-2-one is sourced from PubChem (CID 59300741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).