C12H14F3N3O — CID 59300746
5,6-diamino-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one (PubChem CID 59300746) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 5,6-diamino-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one.
| Compound Name | 5,6-diamino-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one |
|---|---|
| PubChem CID | 59300746 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5,6-diamino-3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one |
| SMILES | CC1(C)C(=O)N(CC(F)(F)F)c2cc(N)c(N)cc21 |
| InChI | InChI=1S/C12H14F3N3O/c1-11(2)6-3-7(16)8(17)4-9(6)18(10(11)19)5-12(13,14)15/h3-4H,5,16-17H2,1-2H3 |
| InChIKey | RBXZBHPOWKAXHA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|