C17H17F2N3O — CID 59300770
5,6-diamino-1-[(2,4-difluorophenyl)methyl]-3,3-dimethylindol-2-one (PubChem CID 59300770) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is 5,6-diamino-1-[(2,4-difluorophenyl)methyl]-3,3-dimethylindol-2-one.
| Compound Name | 5,6-diamino-1-[(2,4-difluorophenyl)methyl]-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 59300770 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5,6-diamino-1-[(2,4-difluorophenyl)methyl]-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(Cc2ccc(F)cc2F)c2cc(N)c(N)cc21 |
| InChI | InChI=1S/C17H17F2N3O/c1-17(2)11-6-13(20)14(21)7-15(11)22(16(17)23)8-9-3-4-10(18)5-12(9)19/h3-7H,8,20-21H2,1-2H3 |
| InChIKey | DEUDIGXDMIHSDT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|