About 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one
2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 59300912) has the molecular formula C22H31N3O
and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| PubChem CID | 59300912 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cc3[nH]c(C4CCCCC4)nc3cc21 |
| InChI | InChI=1S/C22H31N3O/c1-4-5-9-12-25-19-14-18-17(13-16(19)22(2,3)21(25)26)23-20(24-18)15-10-7-6-8-11-15/h13-15H,4-12H2,1-3H3,(H,23,24) |
| InChIKey | VEPNSRNRJJINJJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The IUPAC name of 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one (CID 59300912) is 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
What is the SMILES notation for 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The canonical SMILES for 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one is CCCCCN1C(=O)C(C)(C)c2cc3[nH]c(C4CCCCC4)nc3cc21.
What is the InChIKey of 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
The InChIKey is VEPNSRNRJJINJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O/c1-4-5-9-12-25-19-14-18-17(13-16(19)22(2,3)21(25)26)23-20(24-18)15-10-7-6-8-11-15/h13-15H,4-12H2,1-3H3,(H,23,24).
What are the key properties of 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one?
2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one has a molecular weight of 353.51 g/mol, XLogP of 5.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-7,7-dimethyl-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-6-one is sourced from PubChem (CID 59300912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).