C13H16F3N3O — CID 59300975
5,6-diamino-3,3-dimethyl-1-(3,3,3-trifluoropropyl)indol-2-one (PubChem CID 59300975) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 5,6-diamino-3,3-dimethyl-1-(3,3,3-trifluoropropyl)indol-2-one.
| Compound Name | 5,6-diamino-3,3-dimethyl-1-(3,3,3-trifluoropropyl)indol-2-one |
|---|---|
| PubChem CID | 59300975 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5,6-diamino-3,3-dimethyl-1-(3,3,3-trifluoropropyl)indol-2-one |
| SMILES | CC1(C)C(=O)N(CCC(F)(F)F)c2cc(N)c(N)cc21 |
| InChI | InChI=1S/C13H16F3N3O/c1-12(2)7-5-8(17)9(18)6-10(7)19(11(12)20)4-3-13(14,15)16/h5-6H,3-4,17-18H2,1-2H3 |
| InChIKey | DNAKZTZLAQHJSH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|