C8H2F2O6 — CID 59302058
1,6-difluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 59302058) has the molecular formula C8H2F2O6 and a molecular weight of 232.09 g/mol. Its IUPAC name is 1,6-difluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1,6-difluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 59302058 |
| Molecular Formula | C8H2F2O6 |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 1,6-difluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | O=C1OC(=O)C2(F)C1C1(F)C(=O)OC(=O)C21 |
| InChI | InChI=1S/C8H2F2O6/c9-7-1(3(11)15-5(7)13)8(10)2(7)4(12)16-6(8)14/h1-2H |
| InChIKey | QRKHNQZNJFNTSB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|