C10H15F5O — CID 59302191
1,1,1,3,3-pentafluoro-3-(1-methylcyclohexyl)propan-2-ol (PubChem CID 59302191) has the molecular formula C10H15F5O and a molecular weight of 246.22 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-(1-methylcyclohexyl)propan-2-ol.
| Compound Name | 1,1,1,3,3-pentafluoro-3-(1-methylcyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 59302191 |
| Molecular Formula | C10H15F5O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-(1-methylcyclohexyl)propan-2-ol |
| SMILES | CC1(C(F)(F)C(O)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C10H15F5O/c1-8(5-3-2-4-6-8)9(11,12)7(16)10(13,14)15/h7,16H,2-6H2,1H3 |
| InChIKey | WQZFGDHCAVENBW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |