About 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one
2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one (PubChem CID 59302445) has the molecular formula C21H16F6N2O3
and a molecular weight of 458.36 g/mol. Its IUPAC name is 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one |
| PubChem CID | 59302445 |
| Molecular Formula | C21H16F6N2O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one |
| SMILES | CC(C)n1ncc(-c2ccc(OC(F)(F)F)cc2)c(-c2ccc(OC(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C21H16F6N2O3/c1-12(2)29-19(30)18(14-5-9-16(10-6-14)32-21(25,26)27)17(11-28-29)13-3-7-15(8-4-13)31-20(22,23)24/h3-12H,1-2H3 |
| InChIKey | XTWGCWHUIYEIPX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one?
The IUPAC name of 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one (CID 59302445) is 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one.
What is the SMILES notation for 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one?
The canonical SMILES for 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one is CC(C)n1ncc(-c2ccc(OC(F)(F)F)cc2)c(-c2ccc(OC(F)(F)F)cc2)c1=O.
What is the InChIKey of 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one?
The InChIKey is XTWGCWHUIYEIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F6N2O3/c1-12(2)29-19(30)18(14-5-9-16(10-6-14)32-21(25,26)27)17(11-28-29)13-3-7-15(8-4-13)31-20(22,23)24/h3-12H,1-2H3.
What are the key properties of 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one?
2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one has a molecular weight of 458.36 g/mol, XLogP of 5.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-4,5-bis[4-(trifluoromethoxy)phenyl]pyridazin-3-one is sourced from PubChem (CID 59302445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).