C19H26ClN5O3 — CID 59302716
6-chloro-2-N-cyclohexyl-4-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 59302716) has the molecular formula C19H26ClN5O3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 6-chloro-2-N-cyclohexyl-4-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-cyclohexyl-4-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59302716 |
| Molecular Formula | C19H26ClN5O3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 6-chloro-2-N-cyclohexyl-4-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(CNc2nc(Cl)nc(NC3CCCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26ClN5O3/c1-26-14-9-12(10-15(27-2)16(14)28-3)11-21-18-23-17(20)24-19(25-18)22-13-7-5-4-6-8-13/h9-10,13H,4-8,11H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | QXBUGEWMDKRUFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |