C16H12ClF3N4 — CID 59302787
(12R)-3-chloro-11-(2,4,5-trifluorophenyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine (PubChem CID 59302787) has the molecular formula C16H12ClF3N4 and a molecular weight of 352.75 g/mol. Its IUPAC name is (12R)-3-chloro-11-(2,4,5-trifluorophenyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine.
| Compound Name | (12R)-3-chloro-11-(2,4,5-trifluorophenyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
|---|---|
| PubChem CID | 59302787 |
| Molecular Formula | C16H12ClF3N4 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (12R)-3-chloro-11-(2,4,5-trifluorophenyl)-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-amine |
| SMILES | N[C@H]1Cn2c(nc3ccnc(Cl)c32)CC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H12ClF3N4/c17-16-15-13(1-2-22-16)23-14-4-8(12(21)6-24(14)15)7-3-10(19)11(20)5-9(7)18/h1-3,5,8,12H,4,6,21H2/t8?,12-/m0/s1 |
| InChIKey | BPZLUOPDCROJRR-MYIOLCAUSA-N |
| XLogP | 3.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|