About potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate)
potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) (PubChem CID 59303424) has the molecular formula C18H6KO10-
and a molecular weight of 421.33 g/mol. Its IUPAC name is potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate).
Molecular Properties
| Compound Name | potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) |
| PubChem CID | 59303424 |
| Molecular Formula | C18H6KO10- |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) |
| SMILES | O=C([O-])c1ccc2c(c1)C(=O)OC2=O.O=C([O-])c1ccc2c(c1)C(=O)OC2=O.[K+] |
| InChI | InChI=1S/2C9H4O5.K/c2*10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;/h2*1-3H,(H,10,11);/q;;+1/p-2 |
| InChIKey | NMPMFGZLSNAOFP-UHFFFAOYSA-L |
| XLogP | -4.27 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate)?
The IUPAC name of potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) (CID 59303424) is potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate).
What is the SMILES notation for potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate)?
The canonical SMILES for potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) is O=C([O-])c1ccc2c(c1)C(=O)OC2=O.O=C([O-])c1ccc2c(c1)C(=O)OC2=O.[K+].
What is the InChIKey of potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate)?
The InChIKey is NMPMFGZLSNAOFP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H4O5.K/c2*10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;/h2*1-3H,(H,10,11);/q;;+1/p-2.
What are the key properties of potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate)?
potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) has a molecular weight of 421.33 g/mol, XLogP of -4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for potassium bis(1,3-dioxo-2-benzofuran-5-carboxylate) is sourced from PubChem (CID 59303424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).