C28H16CuN4O16 — CID 59303577
copper;bis(6-(4,5-dicarboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid) (PubChem CID 59303577) has the molecular formula C28H16CuN4O16 and a molecular weight of 727.99 g/mol. Its IUPAC name is copper;bis(6-(4,5-dicarboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid).
| Compound Name | copper;bis(6-(4,5-dicarboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid) |
|---|---|
| PubChem CID | 59303577 |
| Molecular Formula | C28H16CuN4O16 |
| Molecular Weight | 727.99 g/mol |
| Exact Mass | 726.99 |
| IUPAC Name | copper;bis(6-(4,5-dicarboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid) |
| SMILES | O=C(O)c1cnc(-c2cc(C(=O)O)c(C(=O)O)cn2)cc1C(=O)O.O=C(O)c1cnc(-c2cc(C(=O)O)c(C(=O)O)cn2)cc1C(=O)O.[Cu] |
| InChI | InChI=1S/2C14H8N2O8.Cu/c2*17-11(18)5-1-9(15-3-7(5)13(21)22)10-2-6(12(19)20)8(4-16-10)14(23)24;/h2*1-4H,(H,17,18)(H,19,20)(H,21,22)(H,23,24); |
| InChIKey | DLPYBZLFGHJFBH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 349.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.99 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |