About CID 59304034
CID 59304034 (PubChem CID 59304034) has the molecular formula C27H33N4O6
and a molecular weight of 509.58 g/mol.
Molecular Properties
| Compound Name | CID 59304034 |
| PubChem CID | 59304034 |
| Molecular Formula | C27H33N4O6 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | — |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C(CNC(=O)C(C)N)N1[CH]C3Cc4cc(C)c(OC)c(O)c4C(N3)C1C2 |
| InChI | InChI=1S/C27H33N4O6/c1-11-6-14-7-15-10-31-17(21(30-15)19(14)23(33)25(11)36-4)8-16-20(18(31)9-29-27(35)13(3)28)24(34)26(37-5)12(2)22(16)32/h6,10,13,15,17-18,21,30,33H,7-9,28H2,1-5H3,(H,29,35) |
| InChIKey | MJOUOMOKNOCXMN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59304034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59304034?
The IUPAC name of CID 59304034 (CID 59304034) is not available.
What is the SMILES notation for CID 59304034?
The canonical SMILES for CID 59304034 is COC1=C(C)C(=O)C2=C(C1=O)C(CNC(=O)C(C)N)N1[CH]C3Cc4cc(C)c(OC)c(O)c4C(N3)C1C2.
What is the InChIKey of CID 59304034?
The InChIKey is MJOUOMOKNOCXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N4O6/c1-11-6-14-7-15-10-31-17(21(30-15)19(14)23(33)25(11)36-4)8-16-20(18(31)9-29-27(35)13(3)28)24(34)26(37-5)12(2)22(16)32/h6,10,13,15,17-18,21,30,33H,7-9,28H2,1-5H3,(H,29,35).
What are the key properties of CID 59304034?
CID 59304034 has a molecular weight of 509.58 g/mol, XLogP of 0.72, 5 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59304034 is sourced from PubChem (CID 59304034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).