About 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol
1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol (PubChem CID 59304265) has the molecular formula C13H20F3NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol |
| PubChem CID | 59304265 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol |
| SMILES | CC(C)(C)C#CCN1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F3NO/c1-11(2,3)5-4-8-17-9-6-12(18,7-10-17)13(14,15)16/h18H,6-10H2,1-3H3 |
| InChIKey | WMPNXOFLIQOFGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol?
The IUPAC name of 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol (CID 59304265) is 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol.
What is the SMILES notation for 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol?
The canonical SMILES for 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol is CC(C)(C)C#CCN1CCC(O)(C(F)(F)F)CC1.
What is the InChIKey of 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol?
The InChIKey is WMPNXOFLIQOFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3NO/c1-11(2,3)5-4-8-17-9-6-12(18,7-10-17)13(14,15)16/h18H,6-10H2,1-3H3.
What are the key properties of 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol?
1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol has a molecular weight of 263.30 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylpent-2-ynyl)-4-(trifluoromethyl)piperidin-4-ol is sourced from PubChem (CID 59304265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).