C19H32O3 — CID 593044
6-hydroxy-3-undecyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 593044) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 6-hydroxy-3-undecyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
| Compound Name | 6-hydroxy-3-undecyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 593044 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 6-hydroxy-3-undecyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | CCCCCCCCCCCC1COC2=C1C(=O)CC(O)C2 |
| InChI | InChI=1S/C19H32O3/c1-2-3-4-5-6-7-8-9-10-11-15-14-22-18-13-16(20)12-17(21)19(15)18/h15-16,20H,2-14H2,1H3 |
| InChIKey | WNWOFQXPZUFLTN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|