C18H31NO3 — CID 593045
3-undecyl-4,5,6,7-tetrahydro-1,2-benzoxazole-4,6-diol (PubChem CID 593045) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-undecyl-4,5,6,7-tetrahydro-1,2-benzoxazole-4,6-diol.
| Compound Name | 3-undecyl-4,5,6,7-tetrahydro-1,2-benzoxazole-4,6-diol |
|---|---|
| PubChem CID | 593045 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-undecyl-4,5,6,7-tetrahydro-1,2-benzoxazole-4,6-diol |
| SMILES | CCCCCCCCCCCc1noc2c1C(O)CC(O)C2 |
| InChI | InChI=1S/C18H31NO3/c1-2-3-4-5-6-7-8-9-10-11-15-18-16(21)12-14(20)13-17(18)22-19-15/h14,16,20-21H,2-13H2,1H3 |
| InChIKey | CRLZTIDDLVPMFC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|