C15H9N3O4 — CID 59304600
5-[(4-isocyanophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304600) has the molecular formula C15H9N3O4 and a molecular weight of 295.25 g/mol. Its IUPAC name is 5-[(4-isocyanophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-[(4-isocyanophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304600 |
| Molecular Formula | C15H9N3O4 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 5-[(4-isocyanophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | [C-]#[N+]c1ccc(Cc2cc(=O)oc3[nH]c(=O)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C15H9N3O4/c1-16-10-4-2-8(3-5-10)6-9-7-11(19)22-14-12(9)13(20)17-15(21)18-14/h2-5,7H,6H2,(H2,17,18,20,21) |
| InChIKey | BIIWZGRRUJVADL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|