C19H19N3O5 — CID 59304650
N-[4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)phenyl]acetamide (PubChem CID 59304650) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)phenyl]acetamide.
| Compound Name | N-[4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 59304650 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[4-(5-butyl-2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-6-yl)phenyl]acetamide |
| SMILES | CCCCc1c(-c2ccc(NC(C)=O)cc2)c(=O)oc2[nH]c(=O)[nH]c(=O)c12 |
| InChI | InChI=1S/C19H19N3O5/c1-3-4-5-13-14(11-6-8-12(9-7-11)20-10(2)23)18(25)27-17-15(13)16(24)21-19(26)22-17/h6-9H,3-5H2,1-2H3,(H,20,23)(H2,21,22,24,26) |
| InChIKey | ROXFNCLGJGYZOH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |