C17H16N2O4 — CID 59304651
5-butyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304651) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is 5-butyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-butyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304651 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-butyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCCCc1c(-c2ccccc2)c(=O)oc2[nH]c(=O)[nH]c(=O)c12 |
| InChI | InChI=1S/C17H16N2O4/c1-2-3-9-11-12(10-7-5-4-6-8-10)16(21)23-15-13(11)14(20)18-17(22)19-15/h4-8H,2-3,9H2,1H3,(H2,18,19,20,22) |
| InChIKey | PEGADCYADQNVMH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |