C19H18N2O4 — CID 59304669
3-cyclobutyl-5-ethyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304669) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-cyclobutyl-5-ethyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclobutyl-5-ethyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304669 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-cyclobutyl-5-ethyl-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCc1c(-c2ccccc2)c(=O)oc2[nH]c(=O)n(C3CCC3)c(=O)c12 |
| InChI | InChI=1S/C19H18N2O4/c1-2-13-14(11-7-4-3-5-8-11)18(23)25-16-15(13)17(22)21(19(24)20-16)12-9-6-10-12/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,20,24) |
| InChIKey | PNRZBRMNNRILRS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |