C19H18N2O4 — CID 59304688
5-(2-cyclobutylethyl)-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304688) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 5-(2-cyclobutylethyl)-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(2-cyclobutylethyl)-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304688 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-(2-cyclobutylethyl)-6-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=c1[nH]c(=O)c2c(CCC3CCC3)c(-c3ccccc3)c(=O)oc2[nH]1 |
| InChI | InChI=1S/C19H18N2O4/c22-16-15-13(10-9-11-5-4-6-11)14(12-7-2-1-3-8-12)18(23)25-17(15)21-19(24)20-16/h1-3,7-8,11H,4-6,9-10H2,(H2,20,21,22,24) |
| InChIKey | GIVQMFIAVXWOHL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |