C19H18F2N2O5 — CID 59304762
2-[2-[3-(1,1-difluoroethyl)phenoxy]ethoxy]-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 59304762) has the molecular formula C19H18F2N2O5 and a molecular weight of 392.36 g/mol. Its IUPAC name is 2-[2-[3-(1,1-difluoroethyl)phenoxy]ethoxy]-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[2-[3-(1,1-difluoroethyl)phenoxy]ethoxy]-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59304762 |
| Molecular Formula | C19H18F2N2O5 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[2-[3-(1,1-difluoroethyl)phenoxy]ethoxy]-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(OCCOc3cccc(C(C)(F)F)c3)[nH]c(=O)c12 |
| InChI | InChI=1S/C19H18F2N2O5/c1-3-11-9-14(24)28-17-15(11)16(25)22-18(23-17)27-8-7-26-13-6-4-5-12(10-13)19(2,20)21/h4-6,9-10H,3,7-8H2,1-2H3,(H,22,23,25) |
| InChIKey | YIZCPMFIZYQMMT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|