C16H21N3O6 — CID 59304770
ethyl N-[(5-hexyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl)oxy]carbamate (PubChem CID 59304770) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is ethyl N-[(5-hexyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl)oxy]carbamate.
| Compound Name | ethyl N-[(5-hexyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl)oxy]carbamate |
|---|---|
| PubChem CID | 59304770 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | ethyl N-[(5-hexyl-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl)oxy]carbamate |
| SMILES | CCCCCCc1cc(=O)oc2nc(ONC(=O)OCC)[nH]c(=O)c12 |
| InChI | InChI=1S/C16H21N3O6/c1-3-5-6-7-8-10-9-11(20)24-14-12(10)13(21)17-15(18-14)25-19-16(22)23-4-2/h9H,3-8H2,1-2H3,(H,19,22)(H,17,18,21) |
| InChIKey | RLRRGCXIHMNMLN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|