C14H10N2O4 — CID 59304872
5-benzyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304872) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 5-benzyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-benzyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304872 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-benzyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=c1[nH]c(=O)c2c(Cc3ccccc3)cc(=O)oc2[nH]1 |
| InChI | InChI=1S/C14H10N2O4/c17-10-7-9(6-8-4-2-1-3-5-8)11-12(18)15-14(19)16-13(11)20-10/h1-5,7H,6H2,(H2,15,16,18,19) |
| InChIKey | VUPOEZCUOWVDLE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |