C15H20N2O5 — CID 59304879
5-(3-cyclopentyloxypropyl)-4a,8a-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 59304879) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-(3-cyclopentyloxypropyl)-4a,8a-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(3-cyclopentyloxypropyl)-4a,8a-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 59304879 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-(3-cyclopentyloxypropyl)-4a,8a-dihydro-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=C1NC(=O)C2C(CCCOC3CCCC3)=CC(=O)OC2N1 |
| InChI | InChI=1S/C15H20N2O5/c18-11-8-9(4-3-7-21-10-5-1-2-6-10)12-13(19)16-15(20)17-14(12)22-11/h8,10,12,14H,1-7H2,(H2,16,17,19,20) |
| InChIKey | PFPBJWJUZKYAFZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|