C19H25FN4OSi — CID 59304994
2-fluoro-1-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine (PubChem CID 59304994) has the molecular formula C19H25FN4OSi and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-fluoro-1-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 59304994 |
| Molecular Formula | C19H25FN4OSi |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-fluoro-1-N-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Nc3ccc(N)cc3F)ccnc21 |
| InChI | InChI=1S/C19H25FN4OSi/c1-26(2,3)11-10-25-13-24-9-7-15-17(6-8-22-19(15)24)23-18-5-4-14(21)12-16(18)20/h4-9,12H,10-11,13,21H2,1-3H3,(H,22,23) |
| InChIKey | LBZMTQGMYXMJKW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|