C20H27FN4OSi — CID 59305012
2-fluoro-1-N-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine (PubChem CID 59305012) has the molecular formula C20H27FN4OSi and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-fluoro-1-N-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 59305012 |
| Molecular Formula | C20H27FN4OSi |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-fluoro-1-N-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]benzene-1,4-diamine |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c2nccc(Nc3ccc(N)cc3F)c12 |
| InChI | InChI=1S/C20H27FN4OSi/c1-14-12-25(13-26-9-10-27(2,3)4)20-19(14)18(7-8-23-20)24-17-6-5-15(22)11-16(17)21/h5-8,11-12H,9-10,13,22H2,1-4H3,(H,23,24) |
| InChIKey | CAZRWAJSVZMVCN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|