C22H24ClF4N3O2Si — CID 59305018
N-[4-[[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]methyl]-3-fluorophenyl]-2,2,2-trifluoroacetamide (PubChem CID 59305018) has the molecular formula C22H24ClF4N3O2Si and a molecular weight of 501.98 g/mol. Its IUPAC name is N-[4-[[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]methyl]-3-fluorophenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]methyl]-3-fluorophenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59305018 |
| Molecular Formula | C22H24ClF4N3O2Si |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | N-[4-[[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]methyl]-3-fluorophenyl]-2,2,2-trifluoroacetamide |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Cc3ccc(NC(=O)C(F)(F)F)cc3F)ccnc21 |
| InChI | InChI=1S/C22H24ClF4N3O2Si/c1-33(2,3)9-8-32-13-30-12-17(23)19-15(6-7-28-20(19)30)10-14-4-5-16(11-18(14)24)29-21(31)22(25,26)27/h4-7,11-12H,8-10,13H2,1-3H3,(H,29,31) |
| InChIKey | YUMCALAAAOLUBK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|